Zu "66550-08-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Quadrone
Artikelnummer: TGM-T36817-5mg
Description: Quadrone, a sesquiterpene originally isolated from *A. terreus*, exhibits cytotoxicity to human carcinoma KB cells in vitro (EC50 = 1.3 µg/ml). Target: Others. Smiles: CC1(C)CC23C4CC(=O)C2COC(=O)C3CCC14
| CAS | 66550-08-1 |
| MW: | 248.322 D |
3.497,00 €
Quadrone
Artikelnummer: Cay26688-2.5
Quadrone is a sesquiterpene originally isolated from A. terreus. It is cytotoxic to human carcinoma KB cells in vitro (EC50 = 1.3 µg/ml).Formal Name: (3aS,5aR,6R,8aR,8bR)-octahydro-10,10-dimethyl-6,8b-ethano-8bH-cyclopenta[de]-2-benzopyran-1,4-dione. CAS Number: 66550-08-1. Synonyms: (-)-Quadrone. Molecular Formula:...
| Schlagworte: | (-)-Quadrone, (3aS,5aR,6R,8aR,8bR)-octahydro-10,10-dimethyl-6,8b-ethano-8bH-cyclopenta[de]-2-benzopyran-1,4-dione |
| Anwendung: | Cytotoxic sesquiterpene |
| CAS | 66550-08-1 |
| MW: | 248.3 D |
ab 376,00 €
