Zu "64564-03-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Guanylyl Imidodiphosphate (lithium salt)
Artikelnummer: TGM-T36009-10mg
Description: Guanylyl Imidodiphosphate (lithium salt) is a non-hydrolyzable GTP analog that increases adenylate cyclase activity. Target: Others. Smiles: [Li].Nc1nc(=O)c2ncn([C@@H]3O[C@H](COP(O)(=O)OP(O)(=O)NP(O)(O)=O)[C@@H](O)[C@H]3O)c2[nH]1
| CAS | 64564-03-0 |
| MW: | 529.14 D |
ab 117,00 €
Guanylyl Imidodiphosphate (lithium salt)
Artikelnummer: Cay16880-10
Guanylyl imidodiphosphate is a nonhydrolyzable analog of GTP that can bind to and irreversibly activate G proteins in the presence of Mg2+. This nucleotide is a potent stimulator of adenylate cyclase. Guanylyl imidodiphosphate is used in studies of protein synthesis since the process of GTP binding, hydrolysis, and...
| Schlagworte: | 5'-guanylic acid, monoanhydride with imidodiphosphoric acid, tetralithium salt |
| Anwendung: | Nonhydrolyzable GTP analog |
| CAS | 64564-03-0 |
| MW: | 545.9 D |
ab 65,00 €
