Zu "62796-29-6" wurden 2 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
Lissamine rhodamine B sulfonyl chloride
Lissamine rhodamine B sulfonyl chloride

Artikelnummer: TGM-T20773-1g

Description: Lissamine rhodamine B sulfonyl chloride is a fluorescent label used for forming stable conjugates with protein. Target: Others. Smiles: O=S(=O)([O-])C=1C=C(C=CC1C=2C=3C=CC(=CC3[O+]=C4C=C(C=CC42)N(CC)CC)N(CC)CC)S(=O)(=O)Cl. References: Lefevre C, Kang HC, Haugland RP, Malekzadeh N, Arttamangkul S,...
CAS 62796-29-6
MW: 577.11 D
2.503,00 €
Bewerten
Lissamine Rhodamine B Sulfonyl Chloride (Sulforhodamine B sulfonyl chloride)
Lissamine Rhodamine B Sulfonyl Chloride (Sulforhodamine B...

Artikelnummer: ABD-470

SRB sulfonyl chloride is highly fluorescent. It reacts with amine compounds such as amino acids, peptides and proteins to give bright red fluorescent conjugates that are extremely stable, and resistant to protease-catalyzed hydrolysis.
Anwendung: Labeling
CAS 62796-29-6
141,00 €
Bewerten