Zu "54029-12-8" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Albendazole sulfoxide
Artikelnummer: TGM-T6372-100mg
Description: Albendazole sulfoxide (Ricobendazole) is a metabolite of Albendazole, an anthelmintic. Target: Parasite, Microtubule Associated. Smiles: CCCS(=O)C1=CC=C2N=C(NC(=O)OC)NC2=C1. References: Zafar A, Ahmad I, Ahmad A, Ahmad M.Int J Pharm. 2016 Mar 30,501(1-2):49-64.
| Schlagworte: | Ricobendazole, Albendazole Oxide |
| Anwendung: | Anthelmintic |
| CAS | 54029-12-8 |
| MW: | 281.33 D |
ab 42,00 €
Ricobendazole
Artikelnummer: Cay21880-10
Ricobendazole, also known as albendazole sulfate, is a benzimidazole agent that inhibits tubulin polymerization and is commonly used as an anthelmintic and antiparasitic agent, with IC90 values ranging from 3.8 x 10-2 to -4 µg/ml against Encephalitozoon species. In vitro, ricobendazole effectively kills Taenia...
| Schlagworte: | Albendazole sulfoxide, N-[6-(propylsulfinyl)-1H-benzimidazol-2-yl]-carbamic acid, methyl ester |
| Anwendung: | Tubulin polymerization inhibitor |
| CAS | 54029-12-8 |
| MW: | 281.3 D |
ab 61,00 €
Ricobendazole
Artikelnummer: LKT-R3310.10
A low-soluble anthelmintic drug.
| Anwendung: | Antihelmintic agent |
| CAS | 54029-12-8 |
| MW: | 281,33 D |
ab 99,00 €
