Zu "451491-47-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
CTB
Artikelnummer: TGM-T9541-100mg
Description: CTB (Cholera Toxin B subunit) is an activator of p300 histone acetyltransferase and induces apoptosis in MCF-7 cells. Target: Epigenetic Reader Domain. Smiles: CCOc1ccccc1C(=O)Nc1ccc(Cl)c(c1)C(F)(F)F. References: Mantelingu K, et al. Activation of p300 histone acetyltransferase by small molecules...
| Schlagworte: | Cholera Toxin B subunit, Cholera Toxin B subunit |
| Anwendung: | p300 activator |
| CAS | 451491-47-7 |
| MW: | 343.73 D |
ab 60,00 €
CTB
Artikelnummer: Cay37480-10
CTB is an activator of the histone acetyltransferase p300. It induces acetylation of core histones in HeLa cells when used at a concentration of 200 µM. CTB (85.43 µM) increases p53 acetylation and induces apoptosis in MCF-7 cells.Formal Name: N-[4-chloro-3-(trifluoromethyl)phenyl]-2-ethoxy-benzamide. CAS Number:...
| Schlagworte: | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-ethoxy-benzamide |
| Anwendung: | p300 activator |
| CAS | 451491-47-7 |
| MW: | 343.7 D |
ab 111,00 €
