Zu "420831-40-9" wurden 4 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
AK-7
Artikelnummer: TGM-T5490-100mg
Description: AK-7 is a brain-permeable SIRT2 inhibitor and to characterize its cholesterol-reducing properties in neuronal models with an IC50 of 15.5 µM. Target: Sirtuin. Smiles: Brc1cccc(NC(=O)c2cccc(c2)S(=O)(=O)N2CCCCCC2)c1. References: Taylor DM, et al. A brain-permeable small molecule reduces neuronal...
| Anwendung: | SIRT2 Inhibitor |
| CAS | 420831-40-9 |
| MW: | 437.35 D |
ab 31,00 €
AK-7
Artikelnummer: LKT-A4002.25
AK-7 is an inhibitor of sirtuin 2 (SIRT2), sirtuins are considered class III histone deacetylases (HDACs). AK-7 exhibits neuroprotective activity, decreasing brain atrophy and improving motor function and survival in animal models of Huntington's disease.
| Schlagworte: | AK7 |
| Anwendung: | SIRT2 inhibitor |
| CAS | 420831-40-9 |
| MW: | 437.35 D |
ab 138,00 €
AK-7
Artikelnummer: Cay14004-10
The sirtuin SIRT2 is a deacetylase which targets alpha-tubulin, histone 4, forkhead transcription factors, and several other substrates. It has roles in metabolic diseases, cancer, age-related disorders, and neurodegenerative diseases, potentially including Alzheimer's, Huntington's, and Parkinson's diseases. AK-7...
| Schlagworte: | N-(3-bromophenyl)-3-[(hexahydro-1H-azepin-1-yl)sulfonyl]-benzamide |
| Anwendung: | SIRT2 Inhibitor |
| CAS | 420831-40-9 |
| MW: | 437.4 D |
ab 100,00 €
AK-7
Artikelnummer: AG-CR1-3511-M005
Brain-permeable SIRT2 (sirtuin 2) inhibitor.
| Schlagworte: | 3-(Azepan-1-ylsulfonyl)-N-(3-bromophenyl) benzamide, N-(3-Bromophenyl)-3-((hexahydro-1H-azepin-1-yl)sulfonyl) benzamide |
| Anwendung: | SIRT2 Inhibitor |
| CAS | 420831-40-9 |
| MW: | 437,4 D |
ab 88,00 €
