Zu "40615-39-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
5'-O-DMT-dT
Artikelnummer: TGM-T40506-100mg
Description: 5'-O-DMT-dT (5'-O-(4,4'-Dimethoxytrityl)thymidine) is a nucleoside derivative used in oligonucleotide synthesis. Target: Others. Smiles: COc1ccc(cc1)C(OC[C@H]1O[C@H](C[C@@H]1O)n1cc(C)c(=O)[nH]c1=O)(c1ccccc1)c1ccc(OC)cc1. References: Lars Holmberg. Method and means for oligonucleotide synthesis....
| Schlagworte: | 5'-O-(4,4'-Dimethoxytrityl)thymidine, 5'-O-DMT-dT |
| CAS | 40615-39-2 |
| MW: | 544.59 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
5'-O-(4,4'-Dimethoxytrityl)thymidine
Artikelnummer: Cay30802-100
5'-O-(4,4'-Dimethoxytitryl)thymidine is a derivative of thymidine containing a dimethoxytrityl protecting group. It has been used as a precursor in the synthesis of oligo-2'-deoxyribonucleotides and phosphoramidate derivatives.Formal Name: 5'-O-[bis(4-methoxyphenyl)phenylmethyl]-thymidine. CAS Number: 40615-39-2....
| Schlagworte: | DMTrT, DMT-T, 5'-O-[bis(4-methoxyphenyl)phenylmethyl]-thymidine |
| Anwendung: | Thymidine derivative, synthetic precursor derivative |
| CAS | 40615-39-2 |
| MW: | 544.6 D |
ab 44,00 €
