Zu "38609-97-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Cridanimod
Artikelnummer: LKT-C691325.100
Cridanimod is a STING agonist in mouse cells but not human cells.9-Oxo-10(9H)-acridineacetic acid (CAS 38609-97-1). SMILES: C1=CC=C2C(=C1)C(=O)C3=CC=CC=C3N2CC(=O)O
| Schlagworte: | 10-carboxymethyl-9-acridanone, CMA, 9-Oxo-10(9H)-acridineacetic acid, 9-Oxoacridine-10-acetic acid |
| Anwendung: | STING agonist |
| CAS | 38609-97-1 |
| MW: | 253.26 D |
ab 99,00 €
Cridanimod
Artikelnummer: TGM-T5317-100mg
Description: Cridanimod (10-carboxymethyl-9-acridanone, CMA) is a potent STING agonist that directly binds to STING and triggers a strong antiviral response through the TBK1/IRF3 route. Target: IFNAR, Progesterone Receptor, STING. Smiles: OC(=O)CN1C2=C(C=CC=C2)C(=O)C2=C1C=CC=C2. References: Cavlar T, et al....
| Schlagworte: | CMA, XBIO-101, 10-carboxymethyl-9-acridanone |
| Anwendung: | Antineoplastic (adjunct) |
| CAS | 38609-97-1 |
| MW: | 253.25 D |
ab 31,00 €
