Zu "300817-68-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
BH3I-1
Artikelnummer: TGM-T1493-100mg
Description: BH3I-1 (BHI1) is a Bcl-2 antagonist. Target: E1/E2/E3 Enzyme, BCL. Smiles: CC(C)C(N1C(=S)S\C(=C\c2ccc(Br)cc2)C1=O)C(O)=O. References: Degterev A, et al. Nat Cell Biol. 2001, 3(2):173-82.
| Schlagworte: | BHI1 |
| Anwendung: | Cell permeable apoptosis inducer, Bcl-xL BH3 peptide binding inhibitor |
| CAS | 300817-68-9 |
| MW: | 400.31 D |
ab 31,00 €
BH3I-1
Artikelnummer: Cay18763-1
The family of Bcl-2 proteins plays pivotal roles in either promoting or preventing apoptosis. Bcl-2 family members contain one or more of four characteristic Bcl-2 homology (BH) domains, which are crucial for function. For example, anti-apoptotic Bcl-2 family proteins prevent death signaling by heterodimerizing with...
| Schlagworte: | 5-[(4-bromophenyl)methylene]-a-(1-methylethyl)-4-oxo-2-thioxo-3-thiazolidineacetic acid |
| Anwendung: | Cell permeable apoptosis inducer, Bcl-xL BH3 peptide binding inhibitor |
| CAS | 300817-68-9 |
| MW: | 400.3 D |
ab 61,00 €
