Zu "289726-02-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Methylpiperidino pyrazole
Artikelnummer: Cay13863-10
Estrogen action is mediated through two estrogen receptor (ER) subtypes, ERalpha and ERbeta, which have distinct target tissue distributions and functional activities. Methylpiperidino pyrazole is an ER antagonist that is highly selective for ERalpha compared to ERbeta (Kis = 5.6 nM and 2.3 µM, respectively). It can...
| Schlagworte: | MPP, 4-[1-(4-hydroxyphenyl)-4-methyl-5-[4-[2-(1-piperidinyl)ethoxy]phenyl]-1H-pyrazol-3-yl]-phenol |
| Anwendung: | ERalpha antagonist |
| CAS | 289726-02-9 |
| MW: | 469.6 D |
ab 111,00 €
Methylpiperidino pyrazole
Artikelnummer: TGM-T21897-10mg
Description: Methylpiperidino pyrazole is an ERalpha inhibitor and can prevent the BPS-induced Rb phosphorylation and cell cycle progression. Target: Estrogen/progestogen Receptor. Smiles: Cc1c(-c(cc2)ccc2OCCN2CCCCC2)n(-c(cc2)ccc2O)nc1-c(cc1)ccc1O. References: Lin Z, et al. Bisphenol S promotes the cell cycle...
| CAS | 289726-02-9 |
| MW: | 469.57 D |
ab 198,00 €
