Zu "289483-69-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
E7820
Artikelnummer: TGM-T4435-100mg
Description: E7820 (ER68203-00) is an angiogenesis inhibitor by suppressing integrin a2 (a cell adhesion molecule expressed on endothelial cells). Target: Integrin. Smiles: Cc1ccc(NS(=O)(=O)c2cccc(c2)C#N)c2[nH]cc(C#N)c12. References: Ito K, Semba T, Uenaka T, et al. Enhanced anti-angiogenic effect of E7820 in...
| Schlagworte: | ER68203-00 |
| CAS | 289483-69-8 |
| MW: | 336.37 D |
ab 31,00 €
E7820
Artikelnummer: Cay25502-10
E7820 is a sulfonamide derivative and an angiogenesis inhibitor that inhibits bFGF- and VEGF-stimulated human umbilical vein endothelial cell (HUVEC) proliferation (IC50s = 0.1 and 0.081 µg/ml, respectively). It inhibits bFGF- and VEGF-stimulated tube formation of HUVECs in a concentration-dependent manner (IC50s =...
| Schlagworte: | 3-cyano-N-(3-cyano-4-methyl-1H-indol-7-yl)-benzenesulfonamide |
| Anwendung: | Angiogenesis inhibitor |
| CAS | 289483-69-8 |
| MW: | 336.4 D |
ab 52,00 €
