Zu "28831-65-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
lithospermic acid
Artikelnummer: TGM-T3683-100mg
Description: lithospermic acid is a potent anti-HIV agent and shows anti-gonadotrophic and anti-thyroidal effects. Target: HIV Protease. Smiles: OC(=O)[C@@H](Cc1ccc(O)c(O)c1)OC(=O)\C=C\c1ccc(O)c2O[C@@H]([C@@H](C(O)=O)c12)c1ccc(O)c(O)c1. References: Xiuli W, Wei G, Mao S.Pharmacokinetic investigation on interaction...
| CAS | 28831-65-4 |
| MW: | 538.46 D |
ab 34,00 €
Lithospermic Acid
Artikelnummer: Cay33694-1
Lithospermic acid is a polyphenol that has been found in S. miltiorrhiza and has diverse biological activities. It inhibits xanthine oxidase (IC50 = 5.2 µg/ml) and scavenges DPPH (Cay-14805) radicals in cell-free assays (IC50 = 23.2 µg/ml). It also inhibits the production of reactive oxygen species (ROS) induced by...
| Schlagworte: | (+)-Lithospermic Acid, Lithospermic Acid A,... |
| Anwendung: | Bioactive polyphenol |
| CAS | 28831-65-4 |
| MW: | 538.5 D |
ab 100,00 €
