Zu "2377352-49-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
GDC-1971
Artikelnummer: TGM-T62798-25mg
Description: GDC-1971 (compound 199) is an inhibitor of SHP2. Target: Others. Smiles: N[C@@H]1c2ccccc2OC11CCN(CC1)c1cnc2c(n[nH]c2n1)N1CCCc2ncccc12
| Anwendung: | Targets tyrosine-protein phosphatase non-receptor type 11 [EC:3.1.3.48] (PTPN11, SHP2) |
| CAS | 2377352-49-1 |
| MW: | 454.53 D |
ab 516,00 €
GDC-1971
Artikelnummer: Cay39884-1
GDC-1971 is an inhibitor of Src homology region 2 domain-containing phosphatase 2 (SHP-2, IC50 = E76K, IC50 = 0.17 µM). GDC-1971 reduces the levels of phosphorylated ERK in a reporter assay using KYSE-520 esophageal cancer cells (IC90 = 0.012 µM) and inhibits proliferation of the same cells (IC50 = 0.32 µM). In...
| Schlagworte: | Migoprotafib,... |
| Anwendung: | SHP2 (PTPN11) inhibitor |
| CAS | 2377352-49-1 |
| MW: | 454.5 D |
ab 116,00 €
