Zu "2316817-88-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
CB-6644
Artikelnummer: TGM-T10693-100mg
Description: CB-6644, a selective inhibitor of the RUVBL1/2 complex, blocks the ATPase activity of RUVBL1/2 with an IC50 of 15 nM. Target: Others. Smiles: CCOc1cc(F)c(Cl)cc1C(=O)NCC(C)(C)CC(=O)Nc1c(COC)n2CCCc3ccccc3-n2c1=O. References: Assimon VA, et al. CB-6644 Is a Selective Inhibitor of the RUVBL1/2 Complex with...
| CAS | 2316817-88-4 |
| MW: | 573.06 D |
ab 228,00 €
CB-6644
Artikelnummer: Cay36125-5
CB-6644 is an inhibitor of the RUVBL1/2 complex, a complex with ATPase activity that regulates several cellular processes, including chromatin remodeling and gene expression. It inhibits the ATPase activity of the RUVBL1/2 complex (IC50 = 15 nM) and is selective for the RUVBL1/2 complex over a panel of 224 ATPases...
| Schlagworte: | 5-chloro-N-[4-[[6,7-dihydro-3-(methoxymethyl)-1-oxo-1H,5H-pyrazolo[1,2-a][1,2]benzodiazepin-2-yl]amino]-2,2-dimethyl-4-oxo... |
| Anwendung: | RUVBL1/2 complex inhibitor |
| CAS | 2316817-88-4 |
| MW: | 573.1 D |
ab 91,00 €
