Zu "2245697-88-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Thalidomide-O-C6-NH2 hydrochloride
Artikelnummer: TGM-T40031-100mg
Description: Thalidomide-O-C6-NH2 hydrochloride (4-((6-aminohexyl)oxy)-2-(2,6-dioxopiperidin-3-yl)isoindoline-1,3-dione hydrochloride) is a synthesized E3 ligase ligand-linker conjugate. Target: E3 Ligase Ligand-Linker Conjugate. Smiles: O=C1N(C(CC2)C(NC2=O)=O)C(C3=C1C=CC=C3OCCCCCCN)=O.[H]Cl. References: Erb MA, et...
| Schlagworte: | 4-((6-aminohexyl)oxy)-2-(2,6-dioxopiperidin-3-yl)isoindoline-1,3-dione hydrochloride |
| Anwendung: | Protac(R) reagent |
| CAS | 2245697-88-3 |
| MW: | 409.86 D |
ab 40,00 €
Thalidomide-O-C6-Amine HCl
Artikelnummer: BPS-82016
Thalidomide-O-C6-Amine HCl is a functionalized cereblon ligand used for PROTAC research. It incorporates an E3 ligase ligand and a C6 alkyl linker to conjugate to a target protein.
| Anwendung: | Protac(R) reagent |
| CAS | 2245697-88-3 |
| MW: | 409,9 D |
954,00 €
