Zu "22144-76-9" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Cytochalasin C
Artikelnummer: TGM-T13630-1mg
Description: Cytochalasin C, a cell-permeable fungal toxin, induces the formation of nuclear sticks and is 10 times less toxic than cytochalasin D in mice. Target: Others. Smiles: [H][C@]12[C@H](Cc3ccccc3)NC(=O)[C@@]11[C@H](OC(C)=O)\C=C\[C@@](C)(O)C(=O)[C@@H](C)C\C=C\[C@@]1([H])[C@H](O)C(C)=C2C. References: Foissner...
| Anwendung: | Actin polymerization inhibitor |
| CAS | 22144-76-9 |
| MW: | 507.62 D |
ab 242,00 €
Cytochalasin C
Artikelnummer: Cay11329-1
Cytochalasin C is an actin polymerization inhibitor and fungal metabolite that has been found in C. globosum. It inhibits actin polymerization when used at a concentration of 10 µM. Cytochalasin C is cytotoxic to HeLa cells (IC50 = 99%. Formulation: (Request formulation change), A powder. Solubility: DMF: Soluble,...
| Schlagworte: | (3S,3aR,6S,6aR,7E,10S,12R,13E,15R,15aR)-15-(acetyloxy)-3,3a,6,6a,9,10,12,15-octahydro-6,12-dihydroxy-4,5,10,12-tetramethyl... |
| Anwendung: | Actin polymerization inhibitor |
| CAS | 22144-76-9 |
| MW: | 507.6 D |
ab 133,00 €
Cytochalasin C
Artikelnummer: LKT-C9880.1
An actin-disrupting agent that increases the rate of transcription of the TGF-beta 1 gene and of the collagenase gene.
| Anwendung: | Actin-disrupting agent |
| CAS | 22144-76-9 |
| MW: | 507,62 D |
ab 374,00 €
