Zu "2152-44-5" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Betamethasone valerate
Artikelnummer: TGM-T1163-100mg
Description: Betamethasone valerate (Luxiq) is a synthetic glucocorticoid with metabolic, immunosuppressive and anti-inflammatory actions. Target: Glucocorticoid Receptor. Smiles: C[C@@]12[C@@](OC(CCCC)=O)(C(CO)=O)[C@@H](C)C[C@]1([C@]3([C@](F)([C@@H](O)C2)[C@]4(C)C(CC3)=CC(=O)C=C4)[H])[H]. References: Ortonne JP, et...
| Schlagworte: | Betaderm, Betamethasone 17-valerate, Luxiq, Betnovate |
| CAS | 2152-44-5 |
| MW: | 476.58 D |
ab 45,00 €
Betamethasone 17-valerate
Artikelnummer: Cay25640-100
Betamethasone 17-valerate is a glucocorticoid with anti-inflammatory activity. It inhibits the binding of the radiolabeled glucocorticoid dexamethasone to human epidermis and mouse skin (IC50s = 5 and 6 nM, respectively). Topical application of betamethasone 17-valerate ointment (0.12%) blocks increases in ear...
| Schlagworte: | 9-fluoro-11beta,21-dihydroxy-16beta-methyl-17-[(1-oxopentyl)oxy]-pregna-1,4-diene-3,20-dione |
| Anwendung: | Antiinflammatory glucocorticoid receptor agonist |
| CAS | 2152-44-5 |
| MW: | 476.6 D |
ab 85,00 €
