Zu "2140316-62-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Vortioxetine D8
Artikelnummer: TGM-T13308-1mg
Description: Vortioxetine D8 is a deuterium-labeled Vortioxetine, a compound that inhibits 5-HT1A, 5-HT1B, 5-HT3A, 5-HT7 receptors and SERT with [Kis: 15 nM, 33 nM, 3.7 nM, 19 nM, and 1.6 nM, respectively]. Smiles: S(C1=C(C=CC=C1)N2C(C(NC(C2([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])C3=C(C)C=C(C)C=C3. References:...
| Schlagworte: | Lu AA 21004 D8 |
| Anwendung: | GC-MS, LC-MS, internal standard, quantification, serotonin receptor antagonist |
| CAS | 2140316-62-5 |
| MW: | 306.5 D |
891,00 €
Vortioxetine-d8
Artikelnummer: Cay28163-1
Vortioxetine-d8 is intended for use as an internal standard for the quantification of vortioxetine (Cay-23694) by GC- or LC-MS. Vortioxetine is a multimodal serotonergic agent that acts as a serotonin (5-HT, Cay-14332) reuptake inhibitor (Ki = 1.6 nM) and binds to the 5-HT1A, 5-HT1B, 5-HT3A, and 5-HT7 receptors (Kis...
| Schlagworte: | 1-(2-((2,4-dimethylphenyl)thio)phenyl)piperazine-2,2,3,3,5,5,6,6-d8 |
| Anwendung: | GC-MS, LC-MS, internal standard, quantification, serotonin receptor antagonist |
| CAS | 2140316-62-5 |
| MW: | 306.5 D |
498,00 €
