Zu "212844-54-7" wurden 3 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
Purvalanol B
Purvalanol B

Artikelnummer: TGM-T7167-100mg

Description: Purvalanol B (NG 95) is a CDK inhibitor that targets Cdk2/cyclin A, Cdk2/cyclin E, Cdk5/p35, and Cdk2/cyclin B, with IC50 values of 6, 9, 6, and 6 nM, respectively. Target: CDK, Parasite. Smiles: CC(C)[C@H](CO)Nc1nc(Nc2ccc(C(O)=O)c(Cl)c2)c2ncn(C(C)C)c2n1. References: Bullard K M , Broccardo C , Keenan...
Schlagworte: NG 95
Anwendung: CDK inhibitor
CAS 212844-54-7
MW: 432.9 D
ab 33,00 €
Bewerten
Purvalanol B
Purvalanol B

Artikelnummer: Cay19115-10

Cyclin-dependent kinases (CDKs) are key regulators of cell cycle progression and are therefore promising targets for cancer therapy. Purvalanol B is a CDK inhibitor that most potently inhibits Cdk2/cyclin A, Cdk2/cyclin E, Cdk5/p35, and Cdk2/cyclin B (IC50s = 6, 9, 6, and 6 nM, respectively). It is inactive against...
Schlagworte: NG 95, 2-chloro-4-[[2-[[(1R)-1-(hydroxymethyl)-2-methylpropyl]amino]-9-(1-methylethyl)-9H-purin-6-yl]amino]-benzoic acid
Anwendung: CDK inhibitor
CAS 212844-54-7
MW: 432.9 D
ab 57,00 €
Bewerten
Purvalanol B
Purvalanol B

Artikelnummer: SYN-1070-M001

Soluble in DMSO or ethanol. Purvalanol B is a cyclin-dependent kinase inhibitor with IC(50) values of 6, 6, 9, > 10,000, and 6nM for cdc2/cyclin B, cdk2/cyclin A, cdk2/cyclin E, cdk4/cyclin D1 and cdk5-p35, respectively. Purvalanol B has also been shown to have anti-proliferative properties, mediated by p42/p44...
Schlagworte: NG95
Anwendung: Cyclin-dependent kinase inhibitor inhibitor
CAS 212844-54-7
MW: 432,9 D
ab 77,00 €
Bewerten