Zu "2090299-48-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NEU
ZA3-Ep10
Artikelnummer: Cay40764-1
Solulibility: Chloroform: Slightly Soluble: 0.1-1 mg/ml: Methanol: Slightly Soluble: 0.1-1 mg/ml.
| Schlagworte: | 10-[2-[bis(2-hydroxydecyl)amino]ethyl]-15-hydroxy-7,13-bis(2-hydroxydecyl)-N,N-dimethyl-4-oxo-N-(3-sulfopropyl)-3,7,10,13-... |
| Anwendung: | Zwitterionic aminolipid, LNP formation |
| CAS | 2090299-48-0 |
| MW: | 1191.9 D |
ab 117,00 €
ZA3-Ep10
Artikelnummer: TGM-T74445-50mg
Description: ZA3-Ep10, a zwitterionic lipid, is utilized in the formulation of lipid nanoparticles for RNA delivery in vivo and non-viral CRISPR/Cas gene editing applications. Target: Others. Smiles: CCCCCCCCC(O)CN(CCN(CCN(CC(O)CCCCCCCC)CC(O)CCCCCCCC)CCN(CC(O)CCCCCCCC)CC(O)CCCCCCCC)CCC(=O)NCC[N+](C)(C)CCCS([O-])(=O)=O
| CAS | 2090299-48-0 |
| MW: | 1191.9 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
