Zu "206184-49-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Tenofovir hydrate
Artikelnummer: TGM-T1649L-1mL
Description: Tenofovir hydrate, a nucleotide reverse transcriptase inhibitor, is used in the treatment of HIV and chronic Hepatitis B. Target: Others. Smiles: C([C@H](OCP(=O)(O)O)C)N1C=2C(N=C1)=C(N)N=CN2.O
| CAS | 206184-49-8 |
| MW: | 305.23 D |
ab 40,00 €
Tenofovir Monohydrate
Artikelnummer: LKT-T1854.25
An antiretroviral drug known as nucleotide analogue reverse transcriptase inhibitors (nRTIs), which block reverse transcriptase, an enzyme crucial to viral production in HIV-infected people. (we sell this as not for human use).
| CAS | 206184-49-8 |
| MW: | 305.23 D |
ab 104,00 €
