Zu "202189-78-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Bilastine
Artikelnummer: TGM-T4250-100mg
Description: Bilastine (Bilaxten) is a novel new-generation antihistamine that is highly selective for the H1 histamine receptor, has a rapid onset and prolonged duration of action. Target: Histamine Receptor. Smiles: CCOCCn1c(nc2ccccc12)C1CCN(CCc2ccc(cc2)C(C)(C)C(O)=O)CC1. References: Wolthers OD.Bilastine: a new...
| Schlagworte: | Bilaxten |
| Anwendung: | Targets histamine receptor H1 (HRH1) |
| CAS | 202189-78-4 |
| MW: | 463.61 D |
ab 40,00 €
Bilastine
Artikelnummer: Cay28375-25
Bilastine is a histamine H1 receptor antagonist (IC50 = 180 nM). It is selective for the histamine H1 receptor in a panel of 30 receptors in vitro at 100 µM. Bilastine prevents microvascular extravasation (ED50 = 185 µg/kg, i.v.), bronchospasm (ED50 = 4.6 µg/kg, i.v.), and systemic anaphylaxis (ED50 = 0.2 µg/kg,...
| Schlagworte: | F-96221-BM1, 4-[2-[4-[1-(2-ethoxyethyl)-1H-benzimidazol-2-yl]-1-piperidinyl]ethyl]-alpha,alpha-dimethyl-benzeneacetic acid |
| Anwendung: | Histamine H1 receptor antagonist |
| CAS | 202189-78-4 |
| MW: | 463.6 D |
ab 61,00 €
