Zu "2016795-77-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
EC330
Artikelnummer: TGM-T7293-100mg
Description: EC330, a novel steroidal LIF inhibitor showed cytotoxicity in various cancer cell lines and NCI-60 cell line panel at low nano-molar range. Target: Others. Smiles: [H][C@@]12CC[C@@](O)(C(F)(F)C#C)[C@@]1(C)C[C@@H](C1=C3CCC(=O)C=C3CC[C@@]21[H])c1ccc(cc1)C1CC1. References: Nair H B , Santhamma B ,...
| Anwendung: | LIF inhibitor |
| CAS | 2016795-77-8 |
| MW: | 462.57 D |
ab 84,00 €
EC330
Artikelnummer: Cay37551-1
EC330 is an inhibitor of leukemia inhibitory factor (LIF) activity. It binds to the LIF receptor (LIFR) and is selectively cytotoxic to MCF-7 cells ectopically overexpressing LIF (IC50 = 0.075 µM) over non-LIF-overexpressing MCF-7 cells (IC50 = 0.245 µM). EC330 reduces ectopic LIF expression-induced increases in the...
| Schlagworte: | (11beta,17beta)-11-(4-cyclopropylphenyl)-17-(1,1-difluoro-2-propyn-1-yl)-17-hydroxy-estra-4,9-dien-3-one |
| Anwendung: | LIF inhibitor |
| CAS | 2016795-77-8 |
| MW: | 462.6 D |
ab 136,00 €
