Zu "18464-39-6" wurden 1 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
Caroxazone
Caroxazone

Artikelnummer: TGM-T25205-100mg

Description: Caroxazone is an antidepressant drug, monoamine oxidase inhibitor (MAOI) that is irreversible and nonselective meanwhile. Target: Others. Smiles: C(C(N)=O)N1CC=2C(OC1=O)=CC=CC2. References: Moretti A, Caccia C, Martini A, Bonollo L, Amico A, Sega R, Nicolella V, Nicolis FB. Effect of caroxazone, a new...
Anwendung: Targets monoamine oxidase [EC:1.4.3.4] (MAO, aofH)
CAS 18464-39-6
MW: 206.2 D
ab 1.520,00 €
Bewerten