Zu "169675-09-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Ro 60-0175
Artikelnummer: Cay29520-1
Ro 60-0175 is an agonist of the serotonin (5-HT) receptor subtype 5-HT2 that stimulates increases in intracellular calcium levels in CHO-K1 cells expressing human 5-HT2A, 5-HT2B, and 5-HT2C receptors (EC50s = 447, 0.9, and 32 nM, respectively). It is selective for human 5-HT2A and 5-HT2C (Kis = 32 and 1 nM,...
| Schlagworte: | (alphaS)-6-chloro-5-fluoro-alpha-methyl-1H-indole-1-ethanamine, (2E)-2-butenedioate |
| Anwendung: | Serotonin receptor 5-HT2 agonist |
| CAS | 169675-09-6 |
| MW: | 342.8 D |
ab 44,00 €
Ro 60-0175 fumarate
Artikelnummer: TGM-T23246-1mg
Description: 5-HT2 receptor agonist. Target: Others. Smiles: OC(=O)\C=C\C(O)=O.C[C@H](N)Cn1ccc2cc(F)c(Cl)cc12
| Anwendung: | Serotonin receptor 5-HT2 agonist |
| CAS | 169675-09-6 |
| MW: | 342.75 D |
ab 77,00 €
