Zu "1413431-07-8" wurden 1 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Ivacaftor-D9
Artikelnummer: TGM-T27098-100mg
Description: CTP-656, a cystic fibrosis transmembrane conductance regulator (CFTR) channel activator, is used potentially for the treatment of cystic fibrosis. Smiles: C(C)(C)(C)C1=C(NC(=O)C=2C(=O)C=3C(NC2)=CC=CC3)C=C(O)C(C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])=C1
| Schlagworte: | deutivacaftor, CTP-656 |
| Anwendung: | Targets cystic fibrosis transmembrane conductance regulator [EC:5.6.1.6] (CFTR, ABCC7) |
| CAS | 1413431-07-8 |
| MW: | 401.55 D |
ab 1.520,00 €
