Zu "1346527-98-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
ML240
Artikelnummer: TGM-T3535-100mg
Description: ML240 is a selective, ATP-competitive p97 inhibitor. Target: p97. Smiles: COc1cccc2c(NCc3ccccc3)nc(nc12)-n1c(N)nc2ccccc12. References: Tsui-Fen Chou et al. Specific Inhibition of p97/VCP ATPase and Kinetic Analysis Demonstrate Interaction between D1 and D2 ATPase domains.
| Anwendung: | p97 ATPase inhibitor |
| CAS | 1346527-98-7 |
| MW: | 396.44 D |
ab 33,00 €
ML-240
Artikelnummer: Cay17373-1
ML-240 is an ATP-competitive inhibitor of the D2 domain of the ATPase p97 (IC50 = 0.11 µM, Ki = 0.22 µM). It disrupts the endoplasmic reticulum-associated degradation (ERAD) and autophagy pathways, preventing the degradation of p97-dependent proteasome substrates (IC50 = 0.9 µM) and causing accumulation of ubiquitin...
| Schlagworte: | 2-(2-amino-1H-benzimidazol-1-yl)-8-methoxy-N-(phenylmethyl)-4-quinazolinamine |
| Anwendung: | p97 ATPase inhibitor |
| CAS | 1346527-98-7 |
| MW: | 396.4 D |
ab 67,00 €
