Zu "1137608-69-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Telotristat Etiprate
Artikelnummer: TGM-T6044-100mg
Description: Telotristat Etiprate (LX 1606 Hippurate) is an orally bioavailable, tryptophan hydroxylase (TPH) inhibitor with potential antiserotonergic activity. Target: Hydroxylase. Smiles: OC(=O)CNC(=O)c1ccccc1.CCOC(=O)[C@@H](N)Cc1ccc(cc1)-c1cc(O[C@H](c2ccc(Cl)cc2-n2ccc(C)n2)C(F)(F)F)nc(N)n1. References: Pappas C,...
| Schlagworte: | LX 1606 Hippurate, LX1606 (Hippurate) |
| Anwendung: | Targets tryptophan 5-monooxygenase [EC:1.14.16.4] (TPH1_2) |
| CAS | 1137608-69-5 |
| MW: | 754.15 D |
ab 40,00 €
Telotristat Etiprate
Artikelnummer: Cay25342-5
Telotristat etiprate is a prodrug form of telotristat, which is an inhibitor of tryptophan hydroxylase 1 (TPH1). Telotristat etiprate (15-300 mg/kg) reduces levels of serotonin (5-HT, Cay-14332) in mouse jejunum and blood but not brain. It inhibits increases in IL-1beta and IL-6 levels, histological damage in the...
| Schlagworte: | LX 1032 hippurate, LX 1606 hippurate,... |
| Anwendung: | TPH1 inhibitor prodrug |
| CAS | 1137608-69-5 |
| MW: | 754.2 D |
ab 128,00 €
