Zu "1129403-56-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Amcasertib
Artikelnummer: TGM-T3995-100mg
Description: Amcasertib (BBI503) is an orally administered investigational agent designed to inhibit cancer stem cell pathways by targeting stemness kinases. Target: Stemness kinase. Smiles: CCN(CC)CCNC(=O)c1c(C)[nH]c(\C=C2\C(=O)Nc3ccc(cc23)-c2csc(n2)-c2ccccc2)c1C. References: Boston Biomedical. 2015, Accessed 18...
| Schlagworte: | BBI503 |
| Anwendung: | Targets homeobox protein Nanog (NANOG) |
| CAS | 1129403-56-0 |
| MW: | 539.69 D |
ab 49,00 €
Amcasertib
Artikelnummer: Cay22980-1
Amcasertib is an inhibitor of cancer stem cells (CSCs). It inhibits the growth of HT-29 and MDA-MB-231 cancer cells (IC50s = 100-250 nM for both) and exhibits a 2-fold increase in potency for a population of SW480 cells enriched for CSCs. Amcasertib reduces spherogenesis of CD44+-enriched FaDu cells. Oral...
| Schlagworte: | BBI503,... |
| Anwendung: | Antineoplastic, cell death inducer |
| CAS | 1129403-56-0 |
| MW: | 539.7 D |
ab 117,00 €
