Zu "1061605-21-7" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Thalidomide-O-COOH
Artikelnummer: TGM-T7753-1mL
Description: Thalidomide-O-COOH (Cereblon ligand 3) is a Thalidomide-based Cereblon ligand utilized for recruiting the CRBN protein and can be linked to a protein ligand via a linker to create PROTACs. Target: Others, Ligand for E3 Ligase. Smiles: O=C1C=2C(C(=O)N1C3C(=O)NC(=O)CC3)=CC=CC2OCC(O)=O
| Schlagworte: | Cereblon ligand 3, E3 ligase Ligand 3, TCE35031 |
| Anwendung: | Protac(R) reagent |
| CAS | 1061605-21-7 |
| MW: | 332.27 D |
ab 30,00 €
Cereblon Ligand 1
Artikelnummer: Cay21589-10
Cereblon ligand 1 is a building block in the synthesis of proteolysis-targeting chimera technologies (PROTACs).Formal Name: 2-[[2-(2,6-dioxo-3-piperidinyl)-2,3-dihydro-1,3-dioxo-1H-isoindol-4-yl]oxy]-acetic acid. CAS Number: 1061605-21-7. Molecular Formula: C15H12N2O7. Formula Weight: 332.3. Purity: >95%....
| Schlagworte: | 2-[[2-(2,6-dioxo-3-piperidinyl)-2,3-dihydro-1,3-dioxo-1H-isoindol-4-yl]oxy]-acetic acid |
| Anwendung: | PROTAC synthesis building block |
| CAS | 1061605-21-7 |
| MW: | 332.3 D |
ab 111,00 €
Thalidomide-Acid
Artikelnummer: BPS-82004-1
Thalidomide-Acid is a linker of Thalidomide which is commonly used as a precursor to PROTAC that hijacks cereblon as the E3 ubiquitin ligase component.
| Anwendung: | Protac(R) reagent |
| CAS | 1061605-21-7 |
| MW: | 332,3 D |
ab 805,00 €
