Zu "1031602-63-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
UNC3230
Artikelnummer: Cay16401-1
Phosphatidylinositol-4-phosphate 5-kinase type-1 gamma (PIP5K1C) is a lipid kinase that generates phosphatidylinositol-4,5-bisphosphate (PIP2) in nociceptive dorsal root ganglia (DRG). Pain sensitization is regulated by multiple signaling pathways that are initiated by phospholipase C-mediated hydrolysis of PIP2....
| Schlagworte: | 5-[(cyclohexylcarbonyl)amino]-2-(phenylamino)-4-thiazolecarboxamide |
| Anwendung: | PIP5K1C inhibitor |
| CAS | 1031602-63-7 |
| MW: | 344.4 D |
ab 66,00 €
UNC3230
Artikelnummer: TGM-T23498-100mg
Description: UNC3230 is a potent, selective, and ATP-competitive PIP5K1C inhibitor with an IC50 of approximately 41 nM. UNC3230 (UNC 3230) also inhibits PIP4K2C. Target: Others. Smiles: NC(=O)c1nc(Nc2ccccc2)sc1NC(=O)C1CCCCC1. References: Wright BD, et al. The lipid kinase PIP5K1C regulates pain signaling and...
| Schlagworte: | UNC 3230 |
| CAS | 1031602-63-7 |
| MW: | 344.43 D |
ab 45,00 €
