Yaddle1

Yaddle1 is an agonist of Piezo1 and a derivative of Yoda1 (Cay-21904). It induces calcium influx in a reporter assay using HEK293A cells expressing human Piezo1 (EC50 = 0.4 µM). Yaddle1 (15 µM) induces calcium influx in primary human CD4+ T cells, which express Piezo1, and does not decrease the viability of isolated human peripheral blood mononuclear cells (PBMCs) when used at a concentration of 20 µM. It also induces activation of protein kinase D (PKD) in primary human aortic endothelial cells in a Piezo1-dependent manner. InChI: InChI=1S/C14H8ClF3N4OS/c15-10-3-1-2-9(14(16,17)18)8(10)7-24-13-22-21-12(23-13)11-6-19-4-5-20-11/h1-6H,7H2 InChIKey: CFUNYUCUSGNBPX-UHFFFAOYSA-N SMILES: ClC1=C(CSC2=NN=C(C3=CN=CC=N3)O2)C(C(F)(F)F)=CC=C1