WDR5-0103

WD-repeat protein 5 (WDR5) is a scaffold protein commonly involved in the formation of nucleosome-modifying protein complexes with histones. For example, WDR5 is a component of a mixed-lineage leukemia (MLL) methyltransferase complex that targets histone 3. WDR5 can also be a component of histone acetyltransferase complexes and can directly bind methylated as well as unmodified histones. WDR5-0103 is a small molecule that binds a peptide-binding pocket on WDR5 (Kd = 450 nM), inhibiting the catalytic activity of the MLL core complex in vitro (IC50 = 39 µM).Formal Name: 3-[(3-methoxybenzoyl)amino]-4-(4-methyl-1-piperazinyl)-benzoic acid, methyl ester. CAS Number: 890190-22-4. Synonyms: WD-Repeat Protein 5-0103. Molecular Formula: C21H25N3O4. Formula Weight: 383.4. Purity: >95%. Formulation: (Request formulation change), A crystalline solid. Solubility: DMF: 33.3 mg/ml, DMF:PBS (pH 7.2) (1:1): 0.5 mg/ml, DMSO: 16.6 mg/ml, Ethanol: 12.5 mg/ml. lambdamax: 212, 264 nm. SMILES: O=C(OC)C1=CC(NC(C2=CC=CC(OC)=C2)=O)=C(N3CCN(C)CC3)C=C1. InChi Code: InChI=1S/C21H25N3O4/c1-23-9-11-24(12-10-23)19-8-7-16(21(26)28-3)14-18(19)22-20(25)15-5-4-6-17(13-15)27-2/h4-8,13-14H,9-12H2,1-3H3,(H,22,25). InChi Key: ZPLBXOVTSNRBFB-UHFFFAOYSA-N.