W1131

Description: W1131, a potent STAT3 inhibitor, effectively triggers ferroptosis and suppresses cancer progression across various models including gastric cancer cell subcutaneous xenograft, organoids, and patient-derived xenograft (PDX). Additionally, W1131 overcomes chemical resistance in cancer cells to 5-FU by regulating cell cycle, DNA damage response, and oxidative phosphorylation pathways, notably the IL6-JAK-STAT3 and ferroptosis pathways [1]. Target: Others. Smiles: N(C(=O)C=1OC(N(=O)=O)=CC1)C2=CC=C(C=3N4C(C=C(C=C4)C=5CCNCC5)=NC3)C=C2