Pirlindole

A selective and reversible MAO-A inhibitor (IC50s = 250 and 34.2 nM for rat brain and heart MAO-A, respectively), selective for MAO-A over MAO-B (Kis = 52,100 and 59,900 nM, for rat brain and heart MAO-B, respectively), reverses the depressive-like effects induced by CMS, increases hippocampal cell proliferation, and reverses CMS-induced dendritic atrophy in granule neurons in rats, inhibits enterovirus-D68 and CV-B3, inhibits CV-B3 genome replication (EC50 = 7.7 µM). Formulation: A crystalline solid. InChI: InChI=1S/C15H18N2/c1-10-5-6-14-12(9-10)11-3-2-4-13-15(11)17(14)8-7-16-13/h5-6,9,13,16H,2-4,7-8H2,1H3. InChIKey: IWVRVEIKCBFZNF-UHFFFAOYSA-N. SMILES: CC1=CC=C(N2C3=C4CCCC3NCC2)C4=C1