p-Benzoyl-L-phenylalanine

BzF is a photoreactive derivative of the amino acid L-phenylalanine (Cay-31498). It can be incorporated into synthetic peptides and used as a photolabel to cross-link the peptides to their protein binding partners to identify the residues involved in peptide-protein interactions. BzF has also been incorporated into G protein-coupled receptors (GPCRs) to identify potential ligand binding sites.Formal Name: 4-benzoyl-L-phenylalanine. CAS Number: 104504-45-2. Synonyms: BzF. Molecular Formula: C16H15NO3. Formula Weight: 269.3. Purity: >95%. Formulation: (Request formulation change), A solid. Solubility: DMF: insol, DMSO: insol, Ethanol: insol, PBS (pH 7.2): insol. lambdamax: 259 nm. SMILES: O=C(C1=CC=CC=C1)C2=CC=C(C=C2)C[C@H](N)C(O)=O. InChi Code: InChI=1S/C16H15NO3/c17-14(16(19)20)10-11-6-8-13(9-7-11)15(18)12-4-2-1-3-5-12/h1-9,14H,10,17H2,(H,19,20)/t14-/m0/s1. InChi Key: TVIDEEHSOPHZBR-AWEZNQCLSA-N.