Zu "104504-45-2" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
4-Benzoyl-L-phenylalanine
Artikelnummer: TGM-T21257-100mg
Description: Algestone is a synthetic dihydroxy derivative of Progesterone, wherein the acetonide group possesses anti-inflammatory properties. Smiles: N[C@@H](Cc1ccc(cc1)C(=O)c1ccccc1)C(O)=O. References: Dormán G. [Estimation of the binding site of drugs by means of new types of photoactive ligands]. Acta Pharm...
| Schlagworte: | 4 Benzoyl L phenylalanine, BzF |
| CAS | 104504-45-2 |
| MW: | 269.3 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
p-Benzoyl-L-phenylalanine
Artikelnummer: Cay36168-5
BzF is a photoreactive derivative of the amino acid L-phenylalanine (Cay-31498). It can be incorporated into synthetic peptides and used as a photolabel to cross-link the peptides to their protein binding partners to identify the residues involved in peptide-protein interactions. BzF has also been incorporated into...
| Schlagworte: | BzF, 4-benzoyl-L-phenylalanine |
| Anwendung: | L-phenylalanine photoreactive derivative |
| CAS | 104504-45-2 |
| MW: | 269.3 D |
ab 44,00 €
L-4-Benzoylphenylalanine
Artikelnummer: CSB-DT3243.1
Amino acids are the basic units of proteins, which are linked by peptide bonds to form polypeptide chains that fold into proteins with specific functions. There are 20 common standard amino acids in nature, primarily distinguished by their side chains (R-groups). These differences give amino acids different...
| CAS | 104504-45-2 |
| MW: | 269.3 D |
116,00 €
