NS 19504

NS 19504 is an activator of large-conductance calcium-activated potassium channels (KCa1.1/BK). It induces currents in whole-cell patch-clamp assays using HEK293 cells expressing human KCa1.1/BK when used at a concentration of 10 µM. NS 19504 decreases the force of spontaneous phasic contractions in isolated and perfused guinea pig bladder smooth muscle strips (EC50 = 640 nM). It inhibits methoxamine-induced contractions in isolated rat saphenous arteries when used at a concentration of 6 µM. InChI: InChI=1S/C10H9BrN2S/c11-8-3-1-7(2-4-8)5-9-6-13-10(12)14-9/h1-4,6H,5H2,(H2,12,13) InChIKey: HGWLTZOMQZIUBW-UHFFFAOYSA-N SMILES: BrC1=CC=C(CC2=CN=C(N)S2)C=C1