L,L-Dityrosine

Description: L,L-Dityrosine, a component found in the acid hydrolysates of various biological materials, such as insect cuticular resilin, plays a significant role in biochemical processes. Target: Others. Smiles: N[C@@H](Cc1ccc(O)c(c1)-c1cc(C[C@H](N)C(O)=O)ccc1O)C(O)=O. References: Kungl AJ, et al. Molecular dynamics simulation of the rare amino acid LL-dityrosine and a dityrosine-containing peptide: comparison with time-resolved fluorescence. Biochim Biophys Acta. 1994 Dec 15,1201(3):345-52.