JNK3 inhibitor-4

Description: JNK3 Inhibitor-4, a potent 2-aryl-1-pyrimidinyl-1H-imidazole-5-yl acetonitrile derivative, demonstrates a strong inhibitory effect on JNK3 with an IC 50 value of 1.0 nM. It exhibits exceptional selectivity against JNK3 when compared to other protein kinases, including isoforms JNK1 (IC 50 = 143.9 nM) and JNK2 (IC 50 = 298.2 nM). Additionally, JNK3 Inhibitor-4 benefits from neuroprotective properties and is predicted to permeate the blood-brain barrier effectively. Target: Others. Smiles: C(C#N)C=1N(C(=NC1)C2=CC3=C(C=C2)C=CC=C3)C4=NC(N[C@@H]5CN(C(=O)C6CC6)CCC5)=NC=C4