IQ-3

IQ-3 is a JNK inhibitor. It is selective for JNKs over a panel of 131 kinases at 10 µM. IQ-3 binds to JNKs (Kd = 0. 0. and 0. µM for JNK1-3), as well as casein kinase 1delta (CK1delta), PI3Kgamma, and MAPK-interacting serine/threonine kinase 2 (MKNK2. Kds = 0. 0. and 1. µM, respectively). It also inhibits NF-kappaB/AP-1 (IC50 = 1. µM in a reporter assay). IQ-3 reduces TNF-alpha and IL-6 production in human Mono-Mac-6 cells (IC50s = 2. and 1. µM, respectively) and isolated human peripheral blood mononuclear cells (PBMCs. IC50s = 4. and 9. µM, respectively), as well as nitric oxide (NO) production in murine J774A. macrophages (IC50 = 6. µM). Formal Name: O-(2-furanylcarbonyl)oxime 11H-indeno[1,2-b]quinoxalin-11-one. CAS Number: 312538-03-7. Molecular Formula: C20H11N3O3. Formula Weight: 341.3. Purity: >98%. Formulation (Request formulation change): A solid. Solubility: DMSO: Sparingly soluble: 1-10 mg/ml. SMILES: O=C(C1=CC=CO1)ON=C2C3=C(C4=CC=CC=C24)N=C5C=CC=CC5=N3. InChi Code: InChI=1S/C20H11N3O3/c24-20(16-10-5-11-25-16)26-23-18-13-7-2-1-6-12(13)17-19(18)22-15-9-4-3-8-14(15)21-17/h1-11H. InChi Key: WBSWWONMTZEOGS-UHFFFAOYSA-N. Storage: -20°C. Stability: > 4 years.