Gonadorelin acetate

Description: Gonadorelin, a gonadotropin-releasing hormone receptor (GNRHR, Ki= 13 nM in CHO cells expressing the human receptor) agonist and tropic hormone, effectively stimulates the release of luteinizing hormone (LH) and follicle-stimulating hormone (FSH) from rat anterior pituitary cultures at 0.1 µg doses. Additionally, it triggers LH release from bovine anterior pituitary cultures at a 1 µM concentration. In vivo, gonadorelin induces ovulation in rats pretreated with fluphenazine (ED50= 610.3 ng/kg). Gonadorelin-based formulations are utilized as diagnostic tools to evaluate pituitary gland function. Target: Others. Smiles: CC(O)=O.CC(C)C[C@H](NC(=O)CNC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CCC(=O)N1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N1CCC[C@H]1C(=O)NCC(N)=O