CRT5

Description: CRT5, a pyrazine benzamide, is a potent and selective PKD inhibitor. It inhibits VEGF-induced phosphorylation of three PKD substrates (IC50s = 1, 2, and 1.5 nM for PKD1, PKD2, and PKD3, respectively), histone deacetylase 5, CREB (cAMP-response-element-binding protein), and HSP27 (heat-shock protein 27) at Ser82. Additionally, CRT5 decreases VEGF-induced endothelial migration, proliferation, and tubulogenesis[1]. Target: Others. Smiles: NC1=C(C=C(C=N1)C2=CC(C(NCCN(C)C)=O)=CC=C2)C3=CC4=C(C=C3)C=C(OCC)C=C4