BIR1

Description: BIR1 is a balloon inducing reagent, which triggers a spontaneous self-organization process, leading to the formation of 3-D balloon like structure during hESC differentiation. Target: Others. Smiles: CC(C)CSC1=NC2=CC=C(C=C2S1)\N=C\C1=C(O)C=CC=C1. References: Geng Y, Feng B. A small molecule-based strategy for endothelial differentiation and three-dimensional morphogenesis from human embryonic stem cells. Heliyon. 2016,2(7):e00133. doi:10.1016/j.heliyon.2016.e00133.