Zu "76383-13-6" wurden 1 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
BIR1
BIR1

Artikelnummer: TGM-T30459-100mg

Description: BIR1 is a balloon inducing reagent, which triggers a spontaneous self-organization process, leading to the formation of 3-D balloon like structure during hESC differentiation. Target: Others. Smiles: CC(C)CSC1=NC2=CC=C(C=C2S1)\N=C\C1=C(O)C=CC=C1. References: Geng Y, Feng B. A small molecule-based...
Schlagworte: Balloon inducing reagent 1, Balloon inducing reagent-1
CAS 76383-13-6
MW: 342.48 D
ab 1.440,00 €
Bewerten