Arphamenine B (hemisulfate)

Aminopeptidase B is a Zn2+-dependent exopeptidase that selectively removes arginine and/or lysine from the amino terminus of peptide substrates. This enzyme is a metalloprotease commonly found on the surface of mammalian cells, including macrophages and lymphocytes. Arphamenine B is an aminopeptidase B inhibitor first isolated from bacteria. Like the aminopeptidase inhibitors bestatin (Cay-70520) and amastatin (Cay-16719), arphamenine B enhances immune responses. Arphamenine B is commonly used to characterize novel proteases.Formal Name: alphaR-[(3S)-3-amino-6-[(aminoiminomethyl)amino]-2-oxohexyl]-4-hydroxy-benzenepropanoic acid, hemisulfate. CAS Number: 144110-38-3. Molecular Formula: C16H24N4O4 . 1/2H2SO4. Formula Weight: 385.4. Purity: >95%. Formulation: (Request formulation change), A crystalline solid. Solubility: DMSO: 0.2 mg/ml, PBS (pH 7.2): 10 mg/ml. lambdamax: 225, 278 nm. SMILES: O=C([C@@H](N)CCCNC(N)=N)C[C@H](C(O)=O)CC1=CC=C(O)C=C1.OS(O)(=O)=O. InChi Code: InChI=1S/2C16H24N4O4.H2O4S/c2*17-13(2-1-7-20-16(18)19)14(22)9-11(15(23)24)8-10-3-5-12(21)6-4-10,1-5(2,3)4/h2*3-6,11,13,21H,1-2,7-9,17H2,(H,23,24)(H4,18,19,20),(H2,1,2,3,4)/t2*11-,13+,/m11./s1. InChi Key: AUNSMFLBHPILAD-VICAHNFPSA-N.