Zu "K01260" wurden 17 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Bestatin
Artikelnummer: Cay21217-100
Bestatin is an aminopeptidase inhibitor originally isolated from S. olivoreticuli. It inhibits aminopeptidase B (IC50 = 0.05 µg/ml), aminopeptidase N (IC50 = 16.9 µM), leucine aminopeptidase (IC50 = 0.01 µg/ml), and the aminopeptidase activity of leukotriene A4 (LTA4) hydrolase (Kapp = 172 nM). It is selective for...
| Schlagworte: | NK 421, NSC 265489, N-[(2S,3R)-3-amino-2-hydroxy-1-oxo-4-phenylbutyl]-L-leucine |
| Anwendung: | Aminopeptidase inhibitor |
| CAS | 58970-76-6 |
| MW: | 308.4 D |
ab 141,00 €
Arphamenine B (hemisulfate)
Artikelnummer: Cay18506-10
Aminopeptidase B is a Zn2+-dependent exopeptidase that selectively removes arginine and/or lysine from the amino terminus of peptide substrates. This enzyme is a metalloprotease commonly found on the surface of mammalian cells, including macrophages and lymphocytes. Arphamenine B is an aminopeptidase B inhibitor...
| Schlagworte: | alphaR-[(3S)-3-amino-6-[(aminoiminomethyl)amino]-2-oxohexyl]-4-hydroxy-benzenepropanoic acid, hemisulfate |
| Anwendung: | Aminopeptidase B inhibitor |
| CAS | 144110-38-3 |
| MW: | 385.4 D |
ab 56,00 €
Bestatin hydrochloride
Artikelnummer: TGM-T3529-25mg
Description: Bestatin hydrochloride (Ubenimex hydrochloride) is an inhibitor of aminopeptidase N (APN)/CD13 and aminopeptidase B. Target: Integrin, Antibacterial, Aminopeptidase, Antibiotic. Smiles: Cl.CC(C)C[C@H](NC(=O)[C@@H](O)[C@H](N)Cc1ccccc1)C(O)=O. References: Hossain A, et al. Protective effects of...
| Schlagworte: | Ubenimex hydrochloride |
| Anwendung: | LTA4 hydrolase inhibitor |
| CAS | 65391-42-6 |
| MW: | 344.84 D |
ab 45,00 €
Anti-RNPEP
Artikelnummer: A305-611A
Protein function: Exopeptidase which selectively removes arginine and/or lysine residues from the N-terminus of several peptide substrates including Arg(0)-Leu-enkephalin, Arg(0)-Met-enkephalin and Arg(- 1)-Lys(0)-somatostatin-14. Can hydrolyze leukotriene A4 (LTA-4) into leukotriene B4 (LTB-4). [The UniProt...
| Schlagworte: | Anti-APB, Anti-AP-B, Anti-RNPEP, EC=3.4.11.6, Anti-Aminopeptidase B, Anti-Arginyl aminopeptidase, Anti-Arginine... |
| Anwendung: | WB, IP |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 165,00 €
Bestatin Hydrochloride
Artikelnummer: LKT-B1874.1
Bestatin is a dipeptide inhibitor of aminopeptidases such as aminopeptidase N/CD13. Bestatin displays efficacy in the treatment of lung cancer. This compound exhibits anticancer chemotherapeutic, immunomodulatory, and analgesic activities. Bestatin enhances differentiation of acute promyelotic leukemia (APL) cells....
| Schlagworte: | Ubenimex hydrochloride |
| Anwendung: | Aminopeptidase inhibitor |
| CAS | 65391-42-6 |
| MW: | 344,87 D |
ab 103,00 €
Ubenimex
Artikelnummer: LKT-U0618.10
Ubenimex is an antitumor agent effective against murine syngeneic tumors including mouse colon 26 and C1498 leukemia. It was active against MNNG-induced rat tumor by oral administration. It inhibits leucine aminopeptidase and aminopeptidase B in cell membrane. It was found to modulate PKCin K562 cells and induce...
| Anwendung: | Apoptosis inducer, Aminopeptidase B inhibitor |
| CAS | 58970-76-6 |
| MW: | 308,37 D |
ab 75,00 €
Anti-RNPEP
Artikelnummer: ATA-HPA036074.100
Protein function: Exopeptidase which selectively removes arginine and/or lysine residues from the N-terminus of several peptide substrates including Arg(0)-Leu-enkephalin, Arg(0)-Met-enkephalin and Arg(-1)-Lys(0)- somatostatin-14. Can hydrolyze leukotriene A4 (LTA-4) into leukotriene B4 (LTB-4). [The UniProt...
| Schlagworte: | Anti-APB, Anti-AP-B, Anti-RNPEP, EC=3.4.11.6, Anti-Aminopeptidase B, Anti-Arginyl aminopeptidase, Anti-Arginine... |
| Anwendung: | ICC, IHC, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 246,00 €
Anti-RNPEP
Artikelnummer: ATA-HPA036075.100
Protein function: Exopeptidase which selectively removes arginine and/or lysine residues from the N-terminus of several peptide substrates including Arg(0)-Leu-enkephalin, Arg(0)-Met-enkephalin and Arg(-1)-Lys(0)- somatostatin-14. Can hydrolyze leukotriene A4 (LTA-4) into leukotriene B4 (LTB-4). [The UniProt...
| Schlagworte: | Anti-APB, Anti-AP-B, Anti-RNPEP, EC=3.4.11.6, Anti-Aminopeptidase B, Anti-Arginyl aminopeptidase, Anti-Arginine... |
| Anwendung: | IHC, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 369,00 €
Anti-RNPEP
Artikelnummer: ATA-HPA061487.100
Protein function: Exopeptidase which selectively removes arginine and/or lysine residues from the N-terminus of several peptide substrates including Arg(0)-Leu-enkephalin, Arg(0)-Met-enkephalin and Arg(-1)-Lys(0)- somatostatin-14. Can hydrolyze leukotriene A4 (LTA-4) into leukotriene B4 (LTB-4). [The UniProt...
| Schlagworte: | Anti-APB, Anti-AP-B, Anti-RNPEP, EC=3.4.11.6, Anti-Aminopeptidase B, Anti-Arginyl aminopeptidase, Anti-Arginine... |
| Anwendung: | IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 369,00 €
RNPEP (human), recombinant protein
Artikelnummer: ABS-PP-25421-L.100
Protein function: Exopeptidase which selectively removes arginine and/or lysine residues from the N-terminus of several peptide substrates including Arg(0)-Leu-enkephalin, Arg(0)-Met-enkephalin and Arg(-1)-Lys(0)- somatostatin-14. Can hydrolyze leukotriene A4 (LTA-4) into leukotriene B4 (LTB-4). [The UniProt...
| Schlagworte: | APB, AP-B, RNPEP, EC=3.4.11.6, Aminopeptidase B, Arginyl aminopeptidase, Arginine aminopeptidase |
| Exprimiert in: | E.coli |
| Ursprungsart: | human |
| MW: | 18 kD |
ab 115,00 €
RNPEP (human), recombinant protein
Artikelnummer: ABS-PP-25421.100
Protein function: Exopeptidase which selectively removes arginine and/or lysine residues from the N-terminus of several peptide substrates including Arg(0)-Leu-enkephalin, Arg(0)-Met-enkephalin and Arg(-1)-Lys(0)- somatostatin-14. Can hydrolyze leukotriene A4 (LTA-4) into leukotriene B4 (LTB-4). [The UniProt...
| Schlagworte: | APB, AP-B, RNPEP, EC=3.4.11.6, Aminopeptidase B, Arginyl aminopeptidase, Arginine aminopeptidase |
| Exprimiert in: | E.coli |
| Ursprungsart: | human |
| MW: | 18 kD |
ab 90,00 €
Anti-RNPEP, ID (RNPEP, APB, Aminopeptidase B, Arginine...
Artikelnummer: 041158.200
Exopeptidase which selectively removes arginine and/or lysine residues from the N-terminus of several peptide substrates including Arg(0)-Leu-enkephalin, Arg(0)-Met-enkephalin and Arg(-1)-Lys(0)-somatostatin-14. Can hydrolyze leukotriene A4 (LTA-4) into leukotriene B4 (LTB-4) (By similarity). Applications: Suitable...
| Schlagworte: | Anti-APB, Anti-AP-B, Anti-RNPEP, EC=3.4.11.6, Anti-Aminopeptidase B, Anti-Arginyl aminopeptidase, Anti-Arginine... |
| Anwendung: | ELISA, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
865,00 €