2'-Deoxyguanosine (hydrate)

2'-Deoxyguanosine is a purine nucleoside with diverse biological activities. It inhibits the clonogenic growth of HL-60 and K562 leukemia cells (IC50s = 80 and 100 µM, respectively). 2'-Deoxyguanosine inhibits the growth of MOLT-4 T cells and MGL-8 B cells by 99. and 68.3%, respectively, when used at a concentration of 50 µM. It increases the number of binucleated cells, a marker of inhibited cytokinesis, in A. sativum meristems. 2'-Deoxyguanosine (>1 µM) also induces relaxation of precontracted isolated bovine lingual artery.InChI: InChI=1S/C10H13N5O4.H2O/c11-10-13-8-7(9(18)14-10)12-3-15(8)6-1-4(17)5(2-16)19-6,/h3-6,16-17H,1-2H2,(H3,11,13,14,18),1H2/t4-,5+,6+,/m0./s1 InChIKey: LZSCQUCOIRGCEJ-FPKZOZHISA-N SMILES: NC1=NC(C(N=CN2[C@]3([H])O[C@H](CO)[C@@H](O)C3)=C2N1)=O.O