1,4-dideoxy-1,4-imino-D-Arabinitol hydrochloride

Description: 1,4-Dideoxy-1,4-imino-D-arabinitol (DAB) functions as an inhibitor of glycogen phosphorylase, a crucial enzyme in glycogenolysis, demonstrating the ability to hinder this process in isolated liver cells (IC50= 1.0 µM) and cerebral cortex and cerebellum homogenates (IC50s = 463 and 383 nM, respectively). Employed extensively in different animal models, DAB inhibits glycogenolysis within the liver and brain. Target: Others. Smiles: Cl.OC[C@H]1NC[C@@H](O)[C@@H]1O