Zu "K26453" wurden 4 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
MPI-0479605
Artikelnummer: Cay44704-1
MPI-0479605 is an inhibitor of monopolar spindle 1 (Mps1. IC50 = 1. nM). It is selective for Mps1 over a panel of 79 kinases at 500 nM. MPI-0479605 induces time-dependent degradation of cyclin B and securin and decreases phosphorylation of mitotic arrest deficient 3 (Mad3), resulting in failed cytokinesis in HeLa...
| Schlagworte: | N6-cyclohexyl-N2-[2-methyl-4-(4-morpholinyl)phenyl]-9H-purine-2,6-diamine |
| Anwendung: | Mps1 (multipolar spindle 1) inhibitor |
| CAS | 1246529-32-7 |
| MW: | 407.52 D |
ab 35,00 €
BAY-1161909
Artikelnummer: Cay41108-1
BAY-1161909 is an inhibitor of monopolar spindle 1 (Mps1, IC50 = 0.34 nM). It inhibits metaphase arrest induced by the antimitotic agent nocodazole (Cay-13857) in HeLa cells (IC50 = 56 nM). BAY-1161909 inhibits proliferation in a panel of 86 cancer cell lines (median IC50 = 6.7 nM). In vivo, BAY-1161909 (2.5 mg/kg)...
| Schlagworte: | Empesertib,... |
| Anwendung: | Mps1 (multipolar spindle 1) inhibitor |
| CAS | 1443763-60-7 |
| MW: | 559.6 D |
ab 84,00 €
Empesertib
Artikelnummer: TGM-T8487-100mg
Description: Empesertib (BAY 1161909) is an orally bioavailable and selective inhibitor Mps1(IC50 < 1 nM), with potential antineoplastic activity. Target: Kinesin. Smiles: COc1cc(ccc1Nc1nc2ccc(cn2n1)-c1ccc(NC(=O)[C@H](C)c2ccc(F)cc2)cc1)S(C)(=O)=O. References: SCHULZE, Volker, et al. PRODRUG DERIVATIVE SOF...
| Schlagworte: | BAY 1161909 |
| Anwendung: | Mps1 (multipolar spindle 1) inhibitor |
| CAS | 1443763-60-7 |
| MW: | 559.61 D |
ab 78,00 €
Anti-MPS1
Artikelnummer: CSB-PA172981XA01DOA.100
Make to order. Production time: 70-80 business days. Deliverables: 1. 200 µg antigen (used as positive control), 2. 1 ml pre-immune serum (used as negative control) , 3. Rabbit polyclonal antibody, antigen affinity purified. Quality Guarantee: 1. Antibody purity > 90% confirmed by SDS-PAGE, 2. Antibody titer > 1:...
| Schlagworte: | Anti-AtPRD2, Anti-Protein MULTIPOLAR SPINDLE 1, Anti-Protein PUTATIVE RECOMBINATION INITIATION DEFECTS 2, MPS1 Antibody |
| Anwendung: | ELISA, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | Arabidopsis thaliana (Mouse-ear cress) |
ab 1.529,00 €
